C10H10ClNOS2 — CID 54226492
5-chloro-3-(3-methylsulfanylphenyl)-1,3-thiazolidin-4-one (PubChem CID 54226492) has the molecular formula C10H10ClNOS2 and a molecular weight of 259.78 g/mol. Its IUPAC name is 5-chloro-3-(3-methylsulfanylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 5-chloro-3-(3-methylsulfanylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 54226492 |
| Molecular Formula | C10H10ClNOS2 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 5-chloro-3-(3-methylsulfanylphenyl)-1,3-thiazolidin-4-one |
| SMILES | CSc1cccc(N2CSC(Cl)C2=O)c1 |
| InChI | InChI=1S/C10H10ClNOS2/c1-14-8-4-2-3-7(5-8)12-6-15-9(11)10(12)13/h2-5,9H,6H2,1H3 |
| InChIKey | QGFKTVIVTLLCNT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|