C15H18N2O2S — CID 64961778
9-(3-methylsulfanylphenyl)-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 64961778) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 9-(3-methylsulfanylphenyl)-6,9-diazaspiro[4.5]decane-7,10-dione.
| Compound Name | 9-(3-methylsulfanylphenyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 64961778 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 9-(3-methylsulfanylphenyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | CSc1cccc(N2CC(=O)NC3(CCCC3)C2=O)c1 |
| InChI | InChI=1S/C15H18N2O2S/c1-20-12-6-4-5-11(9-12)17-10-13(18)16-15(14(17)19)7-2-3-8-15/h4-6,9H,2-3,7-8,10H2,1H3,(H,16,18) |
| InChIKey | BLYSPGFTANXNNE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |