C21H16F3PS — CID 54231803
1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione (PubChem CID 54231803) has the molecular formula C21H16F3PS and a molecular weight of 388.39 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione.
| Compound Name | 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione |
|---|---|
| PubChem CID | 54231803 |
| Molecular Formula | C21H16F3PS |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione |
| SMILES | FC(F)(F)C(=S)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16F3PS/c22-21(23,24)20(26)16-25(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H |
| InChIKey | QJUSSDUAESJMDG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|