About 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione
1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione (PubChem CID 54231803) has the molecular formula C21H16F3PS
and a molecular weight of 388.39 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione.
Molecular Properties
| Compound Name | 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione |
| PubChem CID | 54231803 |
| Molecular Formula | C21H16F3PS |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione |
| SMILES | FC(F)(F)C(=S)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16F3PS/c22-21(23,24)20(26)16-25(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H |
| InChIKey | QJUSSDUAESJMDG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione?
The IUPAC name of 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione (CID 54231803) is 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione.
What is the SMILES notation for 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione?
The canonical SMILES for 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione is FC(F)(F)C(=S)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione?
The InChIKey is QJUSSDUAESJMDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3PS/c22-21(23,24)20(26)16-25(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H.
What are the key properties of 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione?
1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione has a molecular weight of 388.39 g/mol, XLogP of 4.71, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1-trifluoro-3-(triphenyl-λ5-phosphanylidene)propane-2-thione is sourced from PubChem (CID 54231803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).