C23H15F6P — CID 23418758
triphenyl-[4,4,4-trifluoro-3-(trifluoromethyl)buta-1,2-dienylidene]-λ5-phosphane (PubChem CID 23418758) has the molecular formula C23H15F6P and a molecular weight of 436.34 g/mol. Its IUPAC name is triphenyl-[4,4,4-trifluoro-3-(trifluoromethyl)buta-1,2-dienylidene]-λ5-phosphane.
| Compound Name | triphenyl-[4,4,4-trifluoro-3-(trifluoromethyl)buta-1,2-dienylidene]-λ5-phosphane |
|---|---|
| PubChem CID | 23418758 |
| Molecular Formula | C23H15F6P |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | triphenyl-[4,4,4-trifluoro-3-(trifluoromethyl)buta-1,2-dienylidene]-λ5-phosphane |
| SMILES | FC(F)(F)C(=C=C=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H15F6P/c24-22(25,26)21(23(27,28)29)16-17-30(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H |
| InChIKey | QKTCGOOSNXZWQK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|