C21H28O — CID 54233936
2-[4-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]cyclohex-2-en-1-ylidene]acetaldehyde (PubChem CID 54233936) has the molecular formula C21H28O and a molecular weight of 296.45 g/mol. Its IUPAC name is 2-[4-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]cyclohex-2-en-1-ylidene]acetaldehyde.
| Compound Name | 2-[4-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]cyclohex-2-en-1-ylidene]acetaldehyde |
|---|---|
| PubChem CID | 54233936 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 2-[4-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]cyclohex-2-en-1-ylidene]acetaldehyde |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=C1C=CC(=CC=O)CC1 |
| InChI | InChI=1S/C21H28O/c1-16(19-10-8-18(9-11-19)13-15-22)7-12-20-17(2)6-5-14-21(20,3)4/h7-8,10,12-13,15H,5-6,9,11,14H2,1-4H3 |
| InChIKey | QLEXUFWJSPRFOP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|