C16H17NO2 — CID 54244494
2-(2-phenylethyl)-4,5-dihydroisoindole-1,3-diol (PubChem CID 54244494) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(2-phenylethyl)-4,5-dihydroisoindole-1,3-diol.
| Compound Name | 2-(2-phenylethyl)-4,5-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54244494 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-(2-phenylethyl)-4,5-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CCc1ccccc1)CCC=C2 |
| InChI | InChI=1S/C16H17NO2/c18-15-13-8-4-5-9-14(13)16(19)17(15)11-10-12-6-2-1-3-7-12/h1-4,6-8,18-19H,5,9-11H2 |
| InChIKey | QSHGRTRMGALGGR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |