C25H45NO5 — CID 54247790
2-dodec-2-enyl-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxybutanedioic acid (PubChem CID 54247790) has the molecular formula C25H45NO5 and a molecular weight of 439.64 g/mol. Its IUPAC name is 2-dodec-2-enyl-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxybutanedioic acid.
| Compound Name | 2-dodec-2-enyl-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxybutanedioic acid |
|---|---|
| PubChem CID | 54247790 |
| Molecular Formula | C25H45NO5 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.33 |
| IUPAC Name | 2-dodec-2-enyl-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxybutanedioic acid |
| SMILES | CCCCCCCCCC=CCC(CC(=O)O)(OC1CC(C)(C)NC(C)(C)C1)C(=O)O |
| InChI | InChI=1S/C25H45NO5/c1-6-7-8-9-10-11-12-13-14-15-16-25(22(29)30,19-21(27)28)31-20-17-23(2,3)26-24(4,5)18-20/h14-15,20,26H,6-13,16-19H2,1-5H3,(H,27,28)(H,29,30) |
| InChIKey | QUNLLNDZMKTUKC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|