C25H37NO — CID 54248293
(2S,4aR)-6-[(4-ethylphenoxy)methyl]-2-pentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile (PubChem CID 54248293) has the molecular formula C25H37NO and a molecular weight of 367.58 g/mol. Its IUPAC name is (2S,4aR)-6-[(4-ethylphenoxy)methyl]-2-pentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile.
| Compound Name | (2S,4aR)-6-[(4-ethylphenoxy)methyl]-2-pentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 54248293 |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | (2S,4aR)-6-[(4-ethylphenoxy)methyl]-2-pentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2-carbonitrile |
| SMILES | CCCCC[C@]1(C#N)CC[C@@H]2CC(COc3ccc(CC)cc3)CCC2C1 |
| InChI | InChI=1S/C25H37NO/c1-3-5-6-14-25(19-26)15-13-22-16-21(7-10-23(22)17-25)18-27-24-11-8-20(4-2)9-12-24/h8-9,11-12,21-23H,3-7,10,13-18H2,1-2H3/t21?,22-,23?,25+/m1/s1 |
| InChIKey | QUWYGWPDJPTCMF-XJAHMCCXSA-N |
| XLogP | 6.93 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|