C14H15NO7S — CID 54252359
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonylmethyl 2-methylprop-2-enoate (PubChem CID 54252359) has the molecular formula C14H15NO7S and a molecular weight of 341.34 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonylmethyl 2-methylprop-2-enoate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54252359 |
| Molecular Formula | C14H15NO7S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCS(=O)(=O)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C14H15NO7S/c1-7(2)14(18)21-6-23(19,20)22-15-12(16)10-8-3-4-9(5-8)11(10)13(15)17/h3-4,8-9,16-17H,1,5-6H2,2H3 |
| InChIKey | QXQOCPSOKXRHMJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|