C31H30N2O3 — CID 54253650
butyl (2S)-2-(3-tritylimidazole-4-carbonyl)cyclopropane-1-carboxylate (PubChem CID 54253650) has the molecular formula C31H30N2O3 and a molecular weight of 478.59 g/mol. Its IUPAC name is butyl (2S)-2-(3-tritylimidazole-4-carbonyl)cyclopropane-1-carboxylate.
| Compound Name | butyl (2S)-2-(3-tritylimidazole-4-carbonyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54253650 |
| Molecular Formula | C31H30N2O3 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | butyl (2S)-2-(3-tritylimidazole-4-carbonyl)cyclopropane-1-carboxylate |
| SMILES | CCCCOC(=O)C1C[C@@H]1C(=O)c1cncn1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30N2O3/c1-2-3-19-36-30(35)27-20-26(27)29(34)28-21-32-22-33(28)31(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,21-22,26-27H,2-3,19-20H2,1H3/t26-,27?/m0/s1 |
| InChIKey | QYMZEOQCUQGUQK-QBHOUYDASA-N |
| XLogP | 5.89 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|