C10H18N2O3S — CID 54265411
(2R)-2-methyl-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-4-oxo-5-sulfanylpentanamide (PubChem CID 54265411) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is (2R)-2-methyl-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-4-oxo-5-sulfanylpentanamide.
| Compound Name | (2R)-2-methyl-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-4-oxo-5-sulfanylpentanamide |
|---|---|
| PubChem CID | 54265411 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (2R)-2-methyl-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-4-oxo-5-sulfanylpentanamide |
| SMILES | CNC(=O)[C@H](C)NC(=O)[C@H](C)CC(=O)CS |
| InChI | InChI=1S/C10H18N2O3S/c1-6(4-8(13)5-16)9(14)12-7(2)10(15)11-3/h6-7,16H,4-5H2,1-3H3,(H,11,15)(H,12,14)/t6-,7+/m1/s1 |
| InChIKey | RGKGONJNSWYULN-RQJHMYQMSA-N |
| XLogP | -0.24 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|