C8H10N2O5 — CID 54269232
(2,5-dioxopyrrolidin-1-yl) 2-formamidopropanoate (PubChem CID 54269232) has the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-formamidopropanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-formamidopropanoate |
|---|---|
| PubChem CID | 54269232 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-formamidopropanoate |
| SMILES | CC(NC=O)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C8H10N2O5/c1-5(9-4-11)8(14)15-10-6(12)2-3-7(10)13/h4-5H,2-3H2,1H3,(H,9,11) |
| InChIKey | GOVPVLBKVSRYFX-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|