C22H19FN4O5 — CID 54273165
2-[2-[6-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-5-fluorobenzotriazol-1-yl]phenoxy]acetic acid (PubChem CID 54273165) has the molecular formula C22H19FN4O5 and a molecular weight of 438.42 g/mol. Its IUPAC name is 2-[2-[6-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-5-fluorobenzotriazol-1-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-[6-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-5-fluorobenzotriazol-1-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 54273165 |
| Molecular Formula | C22H19FN4O5 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-[2-[6-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-5-fluorobenzotriazol-1-yl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1-n1nnc2cc(F)c(N3C(=O)C4CCCCC4C3=O)cc21 |
| InChI | InChI=1S/C22H19FN4O5/c23-14-9-15-18(10-17(14)26-21(30)12-5-1-2-6-13(12)22(26)31)27(25-24-15)16-7-3-4-8-19(16)32-11-20(28)29/h3-4,7-10,12-13H,1-2,5-6,11H2,(H,28,29) |
| InChIKey | RLOZSSOQYNGCLP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|