C21H32NO4P — CID 54280353
[(8R,9S,10R,13S,14S,17S)-17-acetamido-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid (PubChem CID 54280353) has the molecular formula C21H32NO4P and a molecular weight of 393.46 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-17-acetamido-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-17-acetamido-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 54280353 |
| Molecular Formula | C21H32NO4P |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-17-acetamido-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid |
| SMILES | CC(=O)N[C@H]1CC[C@H]2[C@@H]3CC=C4C=C(P(=O)(O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H32NO4P/c1-13(23)22-19-7-6-17-16-5-4-14-12-15(27(24,25)26)8-10-20(14,2)18(16)9-11-21(17,19)3/h4,12,16-19H,5-11H2,1-3H3,(H,22,23)(H2,24,25,26)/t16-,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | RQJLKQUBLTXJHK-PXQJOHHUSA-N |
| XLogP | 4.13 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|