C19H27O3P — CID 57050114
[(8S,9R,10R,13S,14S)-10,13-dimethyl-2,7,8,9,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid (PubChem CID 57050114) has the molecular formula C19H27O3P and a molecular weight of 334.40 g/mol. Its IUPAC name is [(8S,9R,10R,13S,14S)-10,13-dimethyl-2,7,8,9,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid.
| Compound Name | [(8S,9R,10R,13S,14S)-10,13-dimethyl-2,7,8,9,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 57050114 |
| Molecular Formula | C19H27O3P |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | [(8S,9R,10R,13S,14S)-10,13-dimethyl-2,7,8,9,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid |
| SMILES | C[C@]12CCC(P(=O)(O)O)=CC1=CC[C@@H]1[C@H]2C=C[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C19H27O3P/c1-18-9-3-4-16(18)15-6-5-13-12-14(23(20,21)22)7-11-19(13,2)17(15)8-10-18/h5,8,10,12,15-17H,3-4,6-7,9,11H2,1-2H3,(H2,20,21,22)/t15-,16-,17+,18-,19-/m0/s1 |
| InChIKey | JPFWBVPFMVFXDE-OYSTVDSJSA-N |
| XLogP | 4.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|