C22H18F3N5O4S — CID 54296174
[1,3-dimethyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] 4-methylbenzenesulfonate (PubChem CID 54296174) has the molecular formula C22H18F3N5O4S and a molecular weight of 505.48 g/mol. Its IUPAC name is [1,3-dimethyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] 4-methylbenzenesulfonate.
| Compound Name | [1,3-dimethyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54296174 |
| Molecular Formula | C22H18F3N5O4S |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | [1,3-dimethyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(C(=O)c3ccc(-n4cncn4)cc3C(F)(F)F)c(C)nn2C)cc1 |
| InChI | InChI=1S/C22H18F3N5O4S/c1-13-4-7-16(8-5-13)35(32,33)34-21-19(14(2)28-29(21)3)20(31)17-9-6-15(30-12-26-11-27-30)10-18(17)22(23,24)25/h4-12H,1-3H3 |
| InChIKey | SAYIWCHECLRJRM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 108.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|