C17H19NO7 — CID 54300216
furan-2-ylmethyl (1S,2R,4S,6S,10S)-2-methyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate (PubChem CID 54300216) has the molecular formula C17H19NO7 and a molecular weight of 349.34 g/mol. Its IUPAC name is furan-2-ylmethyl (1S,2R,4S,6S,10S)-2-methyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate.
| Compound Name | furan-2-ylmethyl (1S,2R,4S,6S,10S)-2-methyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate |
|---|---|
| PubChem CID | 54300216 |
| Molecular Formula | C17H19NO7 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | furan-2-ylmethyl (1S,2R,4S,6S,10S)-2-methyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylate |
| SMILES | CNC(=O)O[C@@H]1OC=C(C(=O)OCc2ccco2)[C@H]2C[C@@H]3O[C@]3(C)[C@@H]12 |
| InChI | InChI=1S/C17H19NO7/c1-17-12(25-17)6-10-11(14(19)22-7-9-4-3-5-21-9)8-23-15(13(10)17)24-16(20)18-2/h3-5,8,10,12-13,15H,6-7H2,1-2H3,(H,18,20)/t10-,12+,13-,15+,17+/m1/s1 |
| InChIKey | SDQYVZIONBYKTR-JMQDMHAUSA-N |
| XLogP | 1.71 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|