C6H4ClNO3 — CID 54306961
3-(3-chloro-1,2-oxazol-5-yl)prop-2-enoic acid (PubChem CID 54306961) has the molecular formula C6H4ClNO3 and a molecular weight of 173.56 g/mol. Its IUPAC name is 3-(3-chloro-1,2-oxazol-5-yl)prop-2-enoic acid.
| Compound Name | 3-(3-chloro-1,2-oxazol-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 54306961 |
| Molecular Formula | C6H4ClNO3 |
| Molecular Weight | 173.56 g/mol |
| Exact Mass | 172.99 |
| IUPAC Name | 3-(3-chloro-1,2-oxazol-5-yl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(Cl)no1 |
| InChI | InChI=1S/C6H4ClNO3/c7-5-3-4(11-8-5)1-2-6(9)10/h1-3H,(H,9,10) |
| InChIKey | SIEZRBMEOIIOCO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.56 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|