C20H30IN3O6 — CID 54310852
(2,5-dihydroxypyrrol-1-yl) 6-[[4-[[(2-iodoacetyl)amino]methyl]cyclohexanecarbonyl]amino]hexanoate (PubChem CID 54310852) has the molecular formula C20H30IN3O6 and a molecular weight of 535.38 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[[4-[[(2-iodoacetyl)amino]methyl]cyclohexanecarbonyl]amino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[[4-[[(2-iodoacetyl)amino]methyl]cyclohexanecarbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 54310852 |
| Molecular Formula | C20H30IN3O6 |
| Molecular Weight | 535.38 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[[4-[[(2-iodoacetyl)amino]methyl]cyclohexanecarbonyl]amino]hexanoate |
| SMILES | O=C(CI)NCC1CCC(C(=O)NCCCCCC(=O)On2c(O)ccc2O)CC1 |
| InChI | InChI=1S/C20H30IN3O6/c21-12-16(25)23-13-14-5-7-15(8-6-14)20(29)22-11-3-1-2-4-19(28)30-24-17(26)9-10-18(24)27/h9-10,14-15,26-27H,1-8,11-13H2,(H,22,29)(H,23,25) |
| InChIKey | SKTRSCRHFGKXBF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|