C21H19BrF2N4O3S2 — CID 5431226
4-bromo-N-[(Z)-[3-[[4-(difluoromethyl)-6-methylpyrimidin-2-yl]sulfanylmethyl]-4-methoxyphenyl]methylideneamino]benzenesulfonamide (PubChem CID 5431226) has the molecular formula C21H19BrF2N4O3S2 and a molecular weight of 557.44 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-[3-[[4-(difluoromethyl)-6-methylpyrimidin-2-yl]sulfanylmethyl]-4-methoxyphenyl]methylideneamino]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(Z)-[3-[[4-(difluoromethyl)-6-methylpyrimidin-2-yl]sulfanylmethyl]-4-methoxyphenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 5431226 |
| Molecular Formula | C21H19BrF2N4O3S2 |
| Molecular Weight | 557.44 g/mol |
| Exact Mass | 556.01 |
| IUPAC Name | 4-bromo-N-[(Z)-[3-[[4-(difluoromethyl)-6-methylpyrimidin-2-yl]sulfanylmethyl]-4-methoxyphenyl]methylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(/C=N\NS(=O)(=O)c2ccc(Br)cc2)cc1CSc1nc(C)cc(C(F)F)n1 |
| InChI | InChI=1S/C21H19BrF2N4O3S2/c1-13-9-18(20(23)24)27-21(26-13)32-12-15-10-14(3-8-19(15)31-2)11-25-28-33(29,30)17-6-4-16(22)5-7-17/h3-11,20,28H,12H2,1-2H3/b25-11- |
| InChIKey | ODOBSHRFJXXBQB-GATIEOLUSA-N |
| XLogP | 5.10 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|