C22H20F2N4O4S — CID 71944825
N-[[3-[[4-(difluoromethyl)-6-methylpyrimidin-2-yl]sulfanylmethyl]-4-methoxyphenyl]methylideneamino]-3,5-dihydroxybenzamide (PubChem CID 71944825) has the molecular formula C22H20F2N4O4S and a molecular weight of 474.49 g/mol. Its IUPAC name is N-[[3-[[4-(difluoromethyl)-6-methylpyrimidin-2-yl]sulfanylmethyl]-4-methoxyphenyl]methylideneamino]-3,5-dihydroxybenzamide.
| Compound Name | N-[[3-[[4-(difluoromethyl)-6-methylpyrimidin-2-yl]sulfanylmethyl]-4-methoxyphenyl]methylideneamino]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 71944825 |
| Molecular Formula | C22H20F2N4O4S |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | N-[[3-[[4-(difluoromethyl)-6-methylpyrimidin-2-yl]sulfanylmethyl]-4-methoxyphenyl]methylideneamino]-3,5-dihydroxybenzamide |
| SMILES | COc1ccc(C=NNC(=O)c2cc(O)cc(O)c2)cc1CSc1nc(C)cc(C(F)F)n1 |
| InChI | InChI=1S/C22H20F2N4O4S/c1-12-5-18(20(23)24)27-22(26-12)33-11-15-6-13(3-4-19(15)32-2)10-25-28-21(31)14-7-16(29)9-17(30)8-14/h3-10,20,29-30H,11H2,1-2H3,(H,28,31) |
| InChIKey | NMKCLIADKUMJMP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|