C7H15N3O4 — CID 54314946
2-[[amino-[2-hydroperoxyethyl(methyl)amino]methylidene]amino]propanoic acid (PubChem CID 54314946) has the molecular formula C7H15N3O4 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-[[amino-[2-hydroperoxyethyl(methyl)amino]methylidene]amino]propanoic acid.
| Compound Name | 2-[[amino-[2-hydroperoxyethyl(methyl)amino]methylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 54314946 |
| Molecular Formula | C7H15N3O4 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-[[amino-[2-hydroperoxyethyl(methyl)amino]methylidene]amino]propanoic acid |
| SMILES | CC(/N=C(\N)N(C)CCOO)C(=O)O |
| InChI | InChI=1S/C7H15N3O4/c1-5(6(11)12)9-7(8)10(2)3-4-14-13/h5,13H,3-4H2,1-2H3,(H2,8,9)(H,11,12) |
| InChIKey | SNNDQBISYNWURO-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|