9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid

C13H5ClO5 — CID 54321987

IUPAC9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid
SMILESO=C1OC(=O)c2c1cc1c(C(=O)O)cccc1c2Cl
InChIInChI=1S/C13H5ClO5/c14-10-5-2-1-3-6(11(15)16)7(5)4-8-9(10)13(18)19-12(8)17/h1-4H,(H,15,16)
InChIKeySSHWPMLYVWLUFM-UHFFFAOYSA-N
MW276.63 g/mol
LogP2.50
Rot. Bonds1

About 9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid

9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid (PubChem CID 54321987) has the molecular formula C13H5ClO5 and a molecular weight of 276.63 g/mol. Its IUPAC name is 9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid.

Molecular Properties

Compound Name9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid
PubChem CID54321987
Molecular FormulaC13H5ClO5
Molecular Weight276.63 g/mol
Exact Mass275.98
IUPAC Name9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid
SMILESO=C1OC(=O)c2c1cc1c(C(=O)O)cccc1c2Cl
InChIInChI=1S/C13H5ClO5/c14-10-5-2-1-3-6(11(15)16)7(5)4-8-9(10)13(18)19-12(8)17/h1-4H,(H,15,16)
InChIKeySSHWPMLYVWLUFM-UHFFFAOYSA-N
XLogP2.50
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.63
LogP ≤ 52.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid?
The IUPAC name of 9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid (CID 54321987) is 9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid.
What is the SMILES notation for 9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid?
The canonical SMILES for 9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid is O=C1OC(=O)c2c1cc1c(C(=O)O)cccc1c2Cl.
What is the InChIKey of 9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid?
The InChIKey is SSHWPMLYVWLUFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5ClO5/c14-10-5-2-1-3-6(11(15)16)7(5)4-8-9(10)13(18)19-12(8)17/h1-4H,(H,15,16).
What are the key properties of 9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid?
9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid has a molecular weight of 276.63 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-1,3-dioxobenzo[f][2]benzofuran-5-carboxylic acid is sourced from PubChem (CID 54321987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).