C26H50N4O2 — CID 54328687
4-cyclopentyl-1,3-bis[(dibutylamino)methyl]-5-hydroxyimidazol-2-one (PubChem CID 54328687) has the molecular formula C26H50N4O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is 4-cyclopentyl-1,3-bis[(dibutylamino)methyl]-5-hydroxyimidazol-2-one.
| Compound Name | 4-cyclopentyl-1,3-bis[(dibutylamino)methyl]-5-hydroxyimidazol-2-one |
|---|---|
| PubChem CID | 54328687 |
| Molecular Formula | C26H50N4O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.39 |
| IUPAC Name | 4-cyclopentyl-1,3-bis[(dibutylamino)methyl]-5-hydroxyimidazol-2-one |
| SMILES | CCCCN(CCCC)Cn1c(O)c(C2CCCC2)n(CN(CCCC)CCCC)c1=O |
| InChI | InChI=1S/C26H50N4O2/c1-5-9-17-27(18-10-6-2)21-29-24(23-15-13-14-16-23)25(31)30(26(29)32)22-28(19-11-7-3)20-12-8-4/h23,31H,5-22H2,1-4H3 |
| InChIKey | SWTYNMUEPBZBLR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |