C9H14N4O3S2 — CID 54338590
propan-2-yl 2-[[5-(methylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 54338590) has the molecular formula C9H14N4O3S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is propan-2-yl 2-[[5-(methylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | propan-2-yl 2-[[5-(methylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 54338590 |
| Molecular Formula | C9H14N4O3S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | propan-2-yl 2-[[5-(methylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CNC(=O)Nc1nnc(SCC(=O)OC(C)C)s1 |
| InChI | InChI=1S/C9H14N4O3S2/c1-5(2)16-6(14)4-17-9-13-12-8(18-9)11-7(15)10-3/h5H,4H2,1-3H3,(H2,10,11,12,15) |
| InChIKey | TXHPAWGOZBSFDR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|