C21H26N2O4 — CID 54343531
1-[ethyl(phenoxy)amino]-3-[(3-propyl-1,2-benzoxazol-7-yl)oxy]propan-2-ol (PubChem CID 54343531) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[ethyl(phenoxy)amino]-3-[(3-propyl-1,2-benzoxazol-7-yl)oxy]propan-2-ol.
| Compound Name | 1-[ethyl(phenoxy)amino]-3-[(3-propyl-1,2-benzoxazol-7-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 54343531 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[ethyl(phenoxy)amino]-3-[(3-propyl-1,2-benzoxazol-7-yl)oxy]propan-2-ol |
| SMILES | CCCc1noc2c(OCC(O)CN(CC)Oc3ccccc3)cccc12 |
| InChI | InChI=1S/C21H26N2O4/c1-3-9-19-18-12-8-13-20(21(18)26-22-19)25-15-16(24)14-23(4-2)27-17-10-6-5-7-11-17/h5-8,10-13,16,24H,3-4,9,14-15H2,1-2H3 |
| InChIKey | UAQLXWJXXOOOSH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|