C22H28N2O4 — CID 152765974
1-[(3-butyl-1,2-benzoxazol-4-yl)oxy]-3-(2-phenoxyethylamino)propan-2-ol (PubChem CID 152765974) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[(3-butyl-1,2-benzoxazol-4-yl)oxy]-3-(2-phenoxyethylamino)propan-2-ol.
| Compound Name | 1-[(3-butyl-1,2-benzoxazol-4-yl)oxy]-3-(2-phenoxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 152765974 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-[(3-butyl-1,2-benzoxazol-4-yl)oxy]-3-(2-phenoxyethylamino)propan-2-ol |
| SMILES | CCCCc1noc2cccc(OCC(O)CNCCOc3ccccc3)c12 |
| InChI | InChI=1S/C22H28N2O4/c1-2-3-10-19-22-20(11-7-12-21(22)28-24-19)27-16-17(25)15-23-13-14-26-18-8-5-4-6-9-18/h4-9,11-12,17,23,25H,2-3,10,13-16H2,1H3 |
| InChIKey | SOCISMITGHAWSB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|