C12H15Cl2P — CID 54349959
1-benzyl-2,3-dichloro-3-methylphospholane (PubChem CID 54349959) has the molecular formula C12H15Cl2P and a molecular weight of 261.13 g/mol. Its IUPAC name is 1-benzyl-2,3-dichloro-3-methylphospholane.
| Compound Name | 1-benzyl-2,3-dichloro-3-methylphospholane |
|---|---|
| PubChem CID | 54349959 |
| Molecular Formula | C12H15Cl2P |
| Molecular Weight | 261.13 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 1-benzyl-2,3-dichloro-3-methylphospholane |
| SMILES | CC1(Cl)CCP(Cc2ccccc2)C1Cl |
| InChI | InChI=1S/C12H15Cl2P/c1-12(14)7-8-15(11(12)13)9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3 |
| InChIKey | UFAJCSNXGRDPLO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.13 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|