C8H12O3 — CID 543567
2-hydroxy-6-methylcyclohex-3-ene-1-carboxylic acid (PubChem CID 543567) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-hydroxy-6-methylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 2-hydroxy-6-methylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 543567 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2-hydroxy-6-methylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1CC=CC(O)C1C(=O)O |
| InChI | InChI=1S/C8H12O3/c1-5-3-2-4-6(9)7(5)8(10)11/h2,4-7,9H,3H2,1H3,(H,10,11) |
| InChIKey | ILLFSAKCCQDSQW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|