C30H39N3O2 — CID 54357267
tert-butyl N-(1-benzylpiperidin-4-yl)-N-(4-cyano-4-phenylcyclohexyl)carbamate (PubChem CID 54357267) has the molecular formula C30H39N3O2 and a molecular weight of 473.66 g/mol. Its IUPAC name is tert-butyl N-(1-benzylpiperidin-4-yl)-N-(4-cyano-4-phenylcyclohexyl)carbamate.
| Compound Name | tert-butyl N-(1-benzylpiperidin-4-yl)-N-(4-cyano-4-phenylcyclohexyl)carbamate |
|---|---|
| PubChem CID | 54357267 |
| Molecular Formula | C30H39N3O2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | tert-butyl N-(1-benzylpiperidin-4-yl)-N-(4-cyano-4-phenylcyclohexyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(C1CCN(Cc2ccccc2)CC1)C1CCC(C#N)(c2ccccc2)CC1 |
| InChI | InChI=1S/C30H39N3O2/c1-29(2,3)35-28(34)33(27-16-20-32(21-17-27)22-24-10-6-4-7-11-24)26-14-18-30(23-31,19-15-26)25-12-8-5-9-13-25/h4-13,26-27H,14-22H2,1-3H3 |
| InChIKey | UJZFWJFDJBSACN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |