C26H31N5O2S — CID 54358304
N-[6-[(4-aminoquinazolin-2-yl)amino]-6-methylheptyl]naphthalene-1-sulfonamide (PubChem CID 54358304) has the molecular formula C26H31N5O2S and a molecular weight of 477.63 g/mol. Its IUPAC name is N-[6-[(4-aminoquinazolin-2-yl)amino]-6-methylheptyl]naphthalene-1-sulfonamide.
| Compound Name | N-[6-[(4-aminoquinazolin-2-yl)amino]-6-methylheptyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 54358304 |
| Molecular Formula | C26H31N5O2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-[6-[(4-aminoquinazolin-2-yl)amino]-6-methylheptyl]naphthalene-1-sulfonamide |
| SMILES | CC(C)(CCCCCNS(=O)(=O)c1cccc2ccccc12)Nc1nc(N)c2ccccc2n1 |
| InChI | InChI=1S/C26H31N5O2S/c1-26(2,31-25-29-22-15-7-6-14-21(22)24(27)30-25)17-8-3-9-18-28-34(32,33)23-16-10-12-19-11-4-5-13-20(19)23/h4-7,10-16,28H,3,8-9,17-18H2,1-2H3,(H3,27,29,30,31) |
| InChIKey | UKRJTNBMUDOTFF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|