C22H30O5 — CID 54363057
(9S,10R,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-8,10,13-trimethyl-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 54363057) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (9S,10R,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-8,10,13-trimethyl-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (9S,10R,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-8,10,13-trimethyl-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 54363057 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (9S,10R,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-8,10,13-trimethyl-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC3=CC(=O)C=C[C@]3(C)[C@H]1C(O)C[C@@]1(C)[C@H]2CC[C@]1(O)C(=O)CO |
| InChI | InChI=1S/C22H30O5/c1-19-8-5-14(24)10-13(19)4-7-20(2)16-6-9-22(27,17(26)12-23)21(16,3)11-15(25)18(19)20/h5,8,10,15-16,18,23,25,27H,4,6-7,9,11-12H2,1-3H3/t15?,16-,18+,19-,20?,21-,22-/m0/s1 |
| InChIKey | UNVYUAPPXMOICN-XUGDNYPJSA-N |
| XLogP | 1.95 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |