C19H17FN2O2S — CID 54366326
4-[7-(6-fluoro-3-pyridinyl)spiro[3.4]octa-5,7-dien-3-yl]benzenesulfonamide (PubChem CID 54366326) has the molecular formula C19H17FN2O2S and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-[7-(6-fluoro-3-pyridinyl)spiro[3.4]octa-5,7-dien-3-yl]benzenesulfonamide.
| Compound Name | 4-[7-(6-fluoro-3-pyridinyl)spiro[3.4]octa-5,7-dien-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 54366326 |
| Molecular Formula | C19H17FN2O2S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 4-[7-(6-fluoro-3-pyridinyl)spiro[3.4]octa-5,7-dien-3-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2CCC23C=CC(c2ccc(F)nc2)=C3)cc1 |
| InChI | InChI=1S/C19H17FN2O2S/c20-18-6-3-15(12-22-18)14-7-9-19(11-14)10-8-17(19)13-1-4-16(5-2-13)25(21,23)24/h1-7,9,11-12,17H,8,10H2,(H2,21,23,24) |
| InChIKey | UQAWAWAACCJKFC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|