C21H23ClN4O2S — CID 54367484
4-[[4-[3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3,5-dimethyl-2-oxopiperazin-1-yl]methyl]benzenecarboximidamide (PubChem CID 54367484) has the molecular formula C21H23ClN4O2S and a molecular weight of 430.96 g/mol. Its IUPAC name is 4-[[4-[3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3,5-dimethyl-2-oxopiperazin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-[[4-[3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3,5-dimethyl-2-oxopiperazin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 54367484 |
| Molecular Formula | C21H23ClN4O2S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-[[4-[3-(5-chlorothiophen-2-yl)prop-2-enoyl]-3,5-dimethyl-2-oxopiperazin-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2CC(C)N(C(=O)C=Cc3ccc(Cl)s3)C(C)C2=O)cc1 |
| InChI | InChI=1S/C21H23ClN4O2S/c1-13-11-25(12-15-3-5-16(6-4-15)20(23)24)21(28)14(2)26(13)19(27)10-8-17-7-9-18(22)29-17/h3-10,13-14H,11-12H2,1-2H3,(H3,23,24) |
| InChIKey | UQTUEOAFGAUWNJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|