C31H43N5O5 — CID 54370176
[2-(dimethylamino)phenyl] 2-[2-amino-5-[5-[cyclohexyl(2-hydroxyethyl)amino]-5-oxopentoxy]-4H-quinazolin-3-yl]acetate (PubChem CID 54370176) has the molecular formula C31H43N5O5 and a molecular weight of 565.72 g/mol. Its IUPAC name is [2-(dimethylamino)phenyl] 2-[2-amino-5-[5-[cyclohexyl(2-hydroxyethyl)amino]-5-oxopentoxy]-4H-quinazolin-3-yl]acetate.
| Compound Name | [2-(dimethylamino)phenyl] 2-[2-amino-5-[5-[cyclohexyl(2-hydroxyethyl)amino]-5-oxopentoxy]-4H-quinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 54370176 |
| Molecular Formula | C31H43N5O5 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | [2-(dimethylamino)phenyl] 2-[2-amino-5-[5-[cyclohexyl(2-hydroxyethyl)amino]-5-oxopentoxy]-4H-quinazolin-3-yl]acetate |
| SMILES | CN(C)c1ccccc1OC(=O)CN1Cc2c(cccc2OCCCCC(=O)N(CCO)C2CCCCC2)N=C1N |
| InChI | InChI=1S/C31H43N5O5/c1-34(2)26-14-6-7-15-28(26)41-30(39)22-35-21-24-25(33-31(35)32)13-10-16-27(24)40-20-9-8-17-29(38)36(18-19-37)23-11-4-3-5-12-23/h6-7,10,13-16,23,37H,3-5,8-9,11-12,17-22H2,1-2H3,(H2,32,33) |
| InChIKey | USQCNBANBMRPKJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|