C9H25N4OP — CID 54373954
3-N-[bis(dimethylamino)phosphoryl]-3-N-methylbutane-2,3-diamine (PubChem CID 54373954) has the molecular formula C9H25N4OP and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-N-[bis(dimethylamino)phosphoryl]-3-N-methylbutane-2,3-diamine.
| Compound Name | 3-N-[bis(dimethylamino)phosphoryl]-3-N-methylbutane-2,3-diamine |
|---|---|
| PubChem CID | 54373954 |
| Molecular Formula | C9H25N4OP |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3-N-[bis(dimethylamino)phosphoryl]-3-N-methylbutane-2,3-diamine |
| SMILES | CC(N)C(C)N(C)P(=O)(N(C)C)N(C)C |
| InChI | InChI=1S/C9H25N4OP/c1-8(10)9(2)13(7)15(14,11(3)4)12(5)6/h8-9H,10H2,1-7H3 |
| InChIKey | UVDYHASLRLYPEX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|