C21H28F3N5O3 — CID 54381109
1-[[2-methyl-1-[6-(propan-2-yldiazenyl)pyridazin-3-yl]oxypropan-2-yl]amino]-3-[2-(trifluoromethyl)phenoxy]propan-2-ol (PubChem CID 54381109) has the molecular formula C21H28F3N5O3 and a molecular weight of 455.48 g/mol. Its IUPAC name is 1-[[2-methyl-1-[6-(propan-2-yldiazenyl)pyridazin-3-yl]oxypropan-2-yl]amino]-3-[2-(trifluoromethyl)phenoxy]propan-2-ol.
| Compound Name | 1-[[2-methyl-1-[6-(propan-2-yldiazenyl)pyridazin-3-yl]oxypropan-2-yl]amino]-3-[2-(trifluoromethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 54381109 |
| Molecular Formula | C21H28F3N5O3 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 1-[[2-methyl-1-[6-(propan-2-yldiazenyl)pyridazin-3-yl]oxypropan-2-yl]amino]-3-[2-(trifluoromethyl)phenoxy]propan-2-ol |
| SMILES | CC(C)/N=N/c1ccc(OCC(C)(C)NCC(O)COc2ccccc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C21H28F3N5O3/c1-14(2)26-27-18-9-10-19(29-28-18)32-13-20(3,4)25-11-15(30)12-31-17-8-6-5-7-16(17)21(22,23)24/h5-10,14-15,25,30H,11-13H2,1-4H3/b27-26+ |
| InChIKey | UZYKTJWDTSMZGP-CYYJNZCTSA-N |
| XLogP | 4.17 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|