C11H17NO — CID 54387723
3a,6,7-trimethyl-3,6,7,7a-tetrahydro-2H-isoindol-1-one (PubChem CID 54387723) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 3a,6,7-trimethyl-3,6,7,7a-tetrahydro-2H-isoindol-1-one.
| Compound Name | 3a,6,7-trimethyl-3,6,7,7a-tetrahydro-2H-isoindol-1-one |
|---|---|
| PubChem CID | 54387723 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3a,6,7-trimethyl-3,6,7,7a-tetrahydro-2H-isoindol-1-one |
| SMILES | CC1C=CC2(C)CNC(=O)C2C1C |
| InChI | InChI=1S/C11H17NO/c1-7-4-5-11(3)6-12-10(13)9(11)8(7)2/h4-5,7-9H,6H2,1-3H3,(H,12,13) |
| InChIKey | VEKYAZKCSPJSJU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|