C19H24N2O2S — CID 54399393
8-[2-(diethylamino)ethylamino]-9H-thioxanthene-2,4-diol (PubChem CID 54399393) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 8-[2-(diethylamino)ethylamino]-9H-thioxanthene-2,4-diol.
| Compound Name | 8-[2-(diethylamino)ethylamino]-9H-thioxanthene-2,4-diol |
|---|---|
| PubChem CID | 54399393 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 8-[2-(diethylamino)ethylamino]-9H-thioxanthene-2,4-diol |
| SMILES | CCN(CC)CCNc1cccc2c1Cc1cc(O)cc(O)c1S2 |
| InChI | InChI=1S/C19H24N2O2S/c1-3-21(4-2)9-8-20-16-6-5-7-18-15(16)11-13-10-14(22)12-17(23)19(13)24-18/h5-7,10,12,20,22-23H,3-4,8-9,11H2,1-2H3 |
| InChIKey | VMIDQOUQFYAAEF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |