C20H25BrN2O2S — CID 67799243
[7-bromo-1-[2-(diethylamino)ethylamino]-10-oxo-9H-thioxanthen-4-yl]methanol (PubChem CID 67799243) has the molecular formula C20H25BrN2O2S and a molecular weight of 437.40 g/mol. Its IUPAC name is [7-bromo-1-[2-(diethylamino)ethylamino]-10-oxo-9H-thioxanthen-4-yl]methanol.
| Compound Name | [7-bromo-1-[2-(diethylamino)ethylamino]-10-oxo-9H-thioxanthen-4-yl]methanol |
|---|---|
| PubChem CID | 67799243 |
| Molecular Formula | C20H25BrN2O2S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | [7-bromo-1-[2-(diethylamino)ethylamino]-10-oxo-9H-thioxanthen-4-yl]methanol |
| SMILES | CCN(CC)CCNc1ccc(CO)c2c1Cc1cc(Br)ccc1S2=O |
| InChI | InChI=1S/C20H25BrN2O2S/c1-3-23(4-2)10-9-22-18-7-5-14(13-24)20-17(18)12-15-11-16(21)6-8-19(15)26(20)25/h5-8,11,22,24H,3-4,9-10,12-13H2,1-2H3 |
| InChIKey | OGWHQMSOLJELPY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |