C25H24N2O7S — CID 54412416
2-(dibenzofuran-2-ylsulfonylamino)-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 54412416) has the molecular formula C25H24N2O7S and a molecular weight of 496.54 g/mol. Its IUPAC name is 2-(dibenzofuran-2-ylsulfonylamino)-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 2-(dibenzofuran-2-ylsulfonylamino)-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 54412416 |
| Molecular Formula | C25H24N2O7S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 2-(dibenzofuran-2-ylsulfonylamino)-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | CCCC(NC(=O)OCc1ccccc1)(NS(=O)(=O)c1ccc2oc3ccccc3c2c1)C(=O)O |
| InChI | InChI=1S/C25H24N2O7S/c1-2-14-25(23(28)29,26-24(30)33-16-17-8-4-3-5-9-17)27-35(31,32)18-12-13-22-20(15-18)19-10-6-7-11-21(19)34-22/h3-13,15,27H,2,14,16H2,1H3,(H,26,30)(H,28,29) |
| InChIKey | VVBASZBROIISTR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|