C10H12N2S — CID 54413606
1,4-dimethyl-2-methylsulfanylbenzimidazole (PubChem CID 54413606) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is 1,4-dimethyl-2-methylsulfanylbenzimidazole.
| Compound Name | 1,4-dimethyl-2-methylsulfanylbenzimidazole |
|---|---|
| PubChem CID | 54413606 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1,4-dimethyl-2-methylsulfanylbenzimidazole |
| SMILES | CSc1nc2c(C)cccc2n1C |
| InChI | InChI=1S/C10H12N2S/c1-7-5-4-6-8-9(7)11-10(13-3)12(8)2/h4-6H,1-3H3 |
| InChIKey | VVVQYLWECWYNDO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |