C19H30O2 — CID 54414776
3-(2-tert-butyl-1-methoxy-5,5-dimethylhex-1-enyl)phenol (PubChem CID 54414776) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 3-(2-tert-butyl-1-methoxy-5,5-dimethylhex-1-enyl)phenol.
| Compound Name | 3-(2-tert-butyl-1-methoxy-5,5-dimethylhex-1-enyl)phenol |
|---|---|
| PubChem CID | 54414776 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 3-(2-tert-butyl-1-methoxy-5,5-dimethylhex-1-enyl)phenol |
| SMILES | COC(=C(CCC(C)(C)C)C(C)(C)C)c1cccc(O)c1 |
| InChI | InChI=1S/C19H30O2/c1-18(2,3)12-11-16(19(4,5)6)17(21-7)14-9-8-10-15(20)13-14/h8-10,13,20H,11-12H2,1-7H3 |
| InChIKey | VWQGUKHGRYYVSK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|