C21H34O2 — CID 177443741
1-[(Z)-2-tert-butyl-1-methoxy-6,6-dimethylhept-1-enyl]-3-methoxybenzene (PubChem CID 177443741) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 1-[(Z)-2-tert-butyl-1-methoxy-6,6-dimethylhept-1-enyl]-3-methoxybenzene.
| Compound Name | 1-[(Z)-2-tert-butyl-1-methoxy-6,6-dimethylhept-1-enyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 177443741 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 1-[(Z)-2-tert-butyl-1-methoxy-6,6-dimethylhept-1-enyl]-3-methoxybenzene |
| SMILES | CO/C(=C(/CCCC(C)(C)C)C(C)(C)C)c1cccc(OC)c1 |
| InChI | InChI=1S/C21H34O2/c1-20(2,3)14-10-13-18(21(4,5)6)19(23-8)16-11-9-12-17(15-16)22-7/h9,11-12,15H,10,13-14H2,1-8H3/b19-18- |
| InChIKey | PVZYEPDVKBXPNI-HNENSFHCSA-N |
| XLogP | 6.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|