C26H46O4Si3 — CID 67803532
CID 67803532 (PubChem CID 67803532) has the molecular formula C26H46O4Si3 and a molecular weight of 506.91 g/mol.
| Compound Name | CID 67803532 |
|---|---|
| PubChem CID | 67803532 |
| Molecular Formula | C26H46O4Si3 |
| Molecular Weight | 506.91 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | — |
| SMILES | COC(=C(CC(C)(C)C(O[Si]C)O[Si]C)C(C)(C)C)c1cccc(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C26H46O4Si3/c1-24(2,3)21(18-26(7,8)23(28-31-10)29-32-11)22(27-9)19-15-14-16-20(17-19)30-33(12,13)25(4,5)6/h14-17,23H,18H2,1-13H3 |
| InChIKey | MRDCMTYFBGOHDU-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.91 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|