C20H32O2 — CID 54004902
1-(2-tert-butyl-1-methoxy-5,5-dimethylhex-1-enyl)-3-methoxybenzene (PubChem CID 54004902) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 1-(2-tert-butyl-1-methoxy-5,5-dimethylhex-1-enyl)-3-methoxybenzene.
| Compound Name | 1-(2-tert-butyl-1-methoxy-5,5-dimethylhex-1-enyl)-3-methoxybenzene |
|---|---|
| PubChem CID | 54004902 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 1-(2-tert-butyl-1-methoxy-5,5-dimethylhex-1-enyl)-3-methoxybenzene |
| SMILES | COC(=C(CCC(C)(C)C)C(C)(C)C)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H32O2/c1-19(2,3)13-12-17(20(4,5)6)18(22-8)15-10-9-11-16(14-15)21-7/h9-11,14H,12-13H2,1-8H3 |
| InChIKey | KOECRJRRDFGLDQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|