C20H34O3Si — CID 67590412
3-[(Z)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methoxy-3,3-dimethylbut-1-enyl]phenol (PubChem CID 67590412) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is 3-[(Z)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methoxy-3,3-dimethylbut-1-enyl]phenol.
| Compound Name | 3-[(Z)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methoxy-3,3-dimethylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 67590412 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 3-[(Z)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methoxy-3,3-dimethylbut-1-enyl]phenol |
| SMILES | CO/C(=C(\CO[Si](C)(C)C(C)(C)C)C(C)(C)C)c1cccc(O)c1 |
| InChI | InChI=1S/C20H34O3Si/c1-19(2,3)17(14-23-24(8,9)20(4,5)6)18(22-7)15-11-10-12-16(21)13-15/h10-13,21H,14H2,1-9H3/b18-17+ |
| InChIKey | VFABUYKVPCCJGV-ISLYRVAYSA-N |
| XLogP | 5.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|