C23H32O3 — CID 54416348
3-[3-[[(1S,5S)-6-hept-1-enyl-3-hydroxy-2-bicyclo[3.1.0]hexanyl]methyl]phenyl]propanoic acid (PubChem CID 54416348) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 3-[3-[[(1S,5S)-6-hept-1-enyl-3-hydroxy-2-bicyclo[3.1.0]hexanyl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[[(1S,5S)-6-hept-1-enyl-3-hydroxy-2-bicyclo[3.1.0]hexanyl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 54416348 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 3-[3-[[(1S,5S)-6-hept-1-enyl-3-hydroxy-2-bicyclo[3.1.0]hexanyl]methyl]phenyl]propanoic acid |
| SMILES | CCCCCC=CC1[C@H]2C(Cc3cccc(CCC(=O)O)c3)C(O)C[C@@H]12 |
| InChI | InChI=1S/C23H32O3/c1-2-3-4-5-6-10-18-19-15-21(24)20(23(18)19)14-17-9-7-8-16(13-17)11-12-22(25)26/h6-10,13,18-21,23-24H,2-5,11-12,14-15H2,1H3,(H,25,26)/t18?,19-,20?,21?,23+/m0/s1 |
| InChIKey | VXSCBRPLXCVGSO-RHDCMTSYSA-N |
| XLogP | 4.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|