C14H13N5O3 — CID 54420303
1-(2-oxoethylcarbamoyl)-1-phenyl-3-pyrimidin-2-ylurea (PubChem CID 54420303) has the molecular formula C14H13N5O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is 1-(2-oxoethylcarbamoyl)-1-phenyl-3-pyrimidin-2-ylurea.
| Compound Name | 1-(2-oxoethylcarbamoyl)-1-phenyl-3-pyrimidin-2-ylurea |
|---|---|
| PubChem CID | 54420303 |
| Molecular Formula | C14H13N5O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-(2-oxoethylcarbamoyl)-1-phenyl-3-pyrimidin-2-ylurea |
| SMILES | O=CCNC(=O)N(C(=O)Nc1ncccn1)c1ccccc1 |
| InChI | InChI=1S/C14H13N5O3/c20-10-9-17-13(21)19(11-5-2-1-3-6-11)14(22)18-12-15-7-4-8-16-12/h1-8,10H,9H2,(H,17,21)(H,15,16,18,22) |
| InChIKey | BSBLXPSGQOAPLC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|