C23H39NO2 — CID 54423907
N-(3-hydroxypropyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide (PubChem CID 54423907) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide.
| Compound Name | N-(3-hydroxypropyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide |
|---|---|
| PubChem CID | 54423907 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | N-(3-hydroxypropyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC(=O)NCCCO |
| InChI | InChI=1S/C23H39NO2/c1-19(2)10-6-11-20(3)12-7-13-21(4)14-8-15-22(5)18-23(26)24-16-9-17-25/h10,12,14,18,25H,6-9,11,13,15-17H2,1-5H3,(H,24,26) |
| InChIKey | WCSKGQJJNHUXDQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|